C10H22N2O — CID 130780147
4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol (PubChem CID 130780147) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol.
| Compound Name | 4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 130780147 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol |
| SMILES | CC(CN)C1(O)CCN(C)CC1C |
| InChI | InChI=1S/C10H22N2O/c1-8(6-11)10(13)4-5-12(3)7-9(10)2/h8-9,13H,4-7,11H2,1-3H3 |
| InChIKey | JPDWLWUVXCHAGA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |