About 4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol
4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol (PubChem CID 130780147) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol.
Molecular Properties
| Compound Name | 4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol |
| PubChem CID | 130780147 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol |
| SMILES | CC(CN)C1(O)CCN(C)CC1C |
| InChI | InChI=1S/C10H22N2O/c1-8(6-11)10(13)4-5-12(3)7-9(10)2/h8-9,13H,4-7,11H2,1-3H3 |
| InChIKey | JPDWLWUVXCHAGA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol?
The IUPAC name of 4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol (CID 130780147) is 4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol.
What is the SMILES notation for 4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol?
The canonical SMILES for 4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol is CC(CN)C1(O)CCN(C)CC1C.
What is the InChIKey of 4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol?
The InChIKey is JPDWLWUVXCHAGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-8(6-11)10(13)4-5-12(3)7-9(10)2/h8-9,13H,4-7,11H2,1-3H3.
What are the key properties of 4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol?
4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol has a molecular weight of 186.30 g/mol, XLogP of 0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-aminopropan-2-yl)-1,3-dimethylpiperidin-4-ol is sourced from PubChem (CID 130780147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).