C5H4N4OS — CID 130781126
3-methyl-5-(thiadiazol-4-yl)-1,2,4-oxadiazole (PubChem CID 130781126) has the molecular formula C5H4N4OS and a molecular weight of 168.18 g/mol. Its IUPAC name is 3-methyl-5-(thiadiazol-4-yl)-1,2,4-oxadiazole.
| Compound Name | 3-methyl-5-(thiadiazol-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 130781126 |
| Molecular Formula | C5H4N4OS |
| Molecular Weight | 168.18 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 3-methyl-5-(thiadiazol-4-yl)-1,2,4-oxadiazole |
| SMILES | Cc1noc(-c2csnn2)n1 |
| InChI | InChI=1S/C5H4N4OS/c1-3-6-5(10-8-3)4-2-11-9-7-4/h2H,1H3 |
| InChIKey | HDSTZQCNWPGREL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.18 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |