About methyl (3S)-3-hydroxy-4,4-dimethylpentanoate
methyl (3S)-3-hydroxy-4,4-dimethylpentanoate (PubChem CID 13078179) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is methyl (3S)-3-hydroxy-4,4-dimethylpentanoate.
Molecular Properties
| Compound Name | methyl (3S)-3-hydroxy-4,4-dimethylpentanoate |
| PubChem CID | 13078179 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | methyl (3S)-3-hydroxy-4,4-dimethylpentanoate |
| SMILES | COC(=O)C[C@H](O)C(C)(C)C |
| InChI | InChI=1S/C8H16O3/c1-8(2,3)6(9)5-7(10)11-4/h6,9H,5H2,1-4H3/t6-/m0/s1 |
| InChIKey | PRKGPKOSRBEOHZ-LURJTMIESA-N |
| XLogP | 0.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (3S)-3-hydroxy-4,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3S)-3-hydroxy-4,4-dimethylpentanoate?
The IUPAC name of methyl (3S)-3-hydroxy-4,4-dimethylpentanoate (CID 13078179) is methyl (3S)-3-hydroxy-4,4-dimethylpentanoate.
What is the SMILES notation for methyl (3S)-3-hydroxy-4,4-dimethylpentanoate?
The canonical SMILES for methyl (3S)-3-hydroxy-4,4-dimethylpentanoate is COC(=O)C[C@H](O)C(C)(C)C.
What is the InChIKey of methyl (3S)-3-hydroxy-4,4-dimethylpentanoate?
The InChIKey is PRKGPKOSRBEOHZ-LURJTMIESA-N. The full InChI is InChI=1S/C8H16O3/c1-8(2,3)6(9)5-7(10)11-4/h6,9H,5H2,1-4H3/t6-/m0/s1.
What are the key properties of methyl (3S)-3-hydroxy-4,4-dimethylpentanoate?
methyl (3S)-3-hydroxy-4,4-dimethylpentanoate has a molecular weight of 160.21 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-3-hydroxy-4,4-dimethylpentanoate is sourced from PubChem (CID 13078179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).