C7H13NO2S — CID 130782120
(4R)-3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 130782120) has the molecular formula C7H13NO2S and a molecular weight of 175.25 g/mol. Its IUPAC name is (4R)-3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 130782120 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | (4R)-3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CN1CSC(C)(C)[C@H]1C(=O)O |
| InChI | InChI=1S/C7H13NO2S/c1-7(2)5(6(9)10)8(3)4-11-7/h5H,4H2,1-3H3,(H,9,10)/t5-/m1/s1 |
| InChIKey | NWAITXJQZNBRGI-RXMQYKEDSA-N |
| XLogP | 0.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |