C9H8Cl2FN — CID 130782154
(1S)-1-(2,3-dichloro-5-fluorophenyl)prop-2-en-1-amine (PubChem CID 130782154) has the molecular formula C9H8Cl2FN and a molecular weight of 220.07 g/mol. Its IUPAC name is (1S)-1-(2,3-dichloro-5-fluorophenyl)prop-2-en-1-amine.
| Compound Name | (1S)-1-(2,3-dichloro-5-fluorophenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 130782154 |
| Molecular Formula | C9H8Cl2FN |
| Molecular Weight | 220.07 g/mol |
| Exact Mass | 219.00 |
| IUPAC Name | (1S)-1-(2,3-dichloro-5-fluorophenyl)prop-2-en-1-amine |
| SMILES | C=C[C@H](N)c1cc(F)cc(Cl)c1Cl |
| InChI | InChI=1S/C9H8Cl2FN/c1-2-8(13)6-3-5(12)4-7(10)9(6)11/h2-4,8H,1,13H2/t8-/m0/s1 |
| InChIKey | HTCRLZIWDYIUTH-QMMMGPOBSA-N |
| XLogP | 3.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.07 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|