C10H17NOS — CID 130782188
(3R)-3-amino-2,2-dimethyl-3-thiophen-2-ylbutan-1-ol (PubChem CID 130782188) has the molecular formula C10H17NOS and a molecular weight of 199.32 g/mol. Its IUPAC name is (3R)-3-amino-2,2-dimethyl-3-thiophen-2-ylbutan-1-ol.
| Compound Name | (3R)-3-amino-2,2-dimethyl-3-thiophen-2-ylbutan-1-ol |
|---|---|
| PubChem CID | 130782188 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (3R)-3-amino-2,2-dimethyl-3-thiophen-2-ylbutan-1-ol |
| SMILES | CC(C)(CO)[C@@](C)(N)c1cccs1 |
| InChI | InChI=1S/C10H17NOS/c1-9(2,7-12)10(3,11)8-5-4-6-13-8/h4-6,12H,7,11H2,1-3H3/t10-/m0/s1 |
| InChIKey | MHDQGULBDFNEFV-JTQLQIEISA-N |
| XLogP | 1.94 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |