About 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole
3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole (PubChem CID 13078368) has the molecular formula C28H27F3N2O
and a molecular weight of 464.53 g/mol. Its IUPAC name is 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole.
Molecular Properties
| Compound Name | 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole |
| PubChem CID | 13078368 |
| Molecular Formula | C28H27F3N2O |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole |
| SMILES | Fc1ccc(C(CCCN2CCC(c3noc4cc(F)ccc34)CC2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H27F3N2O/c29-22-7-3-19(4-8-22)25(20-5-9-23(30)10-6-20)2-1-15-33-16-13-21(14-17-33)28-26-12-11-24(31)18-27(26)34-32-28/h3-12,18,21,25H,1-2,13-17H2 |
| InChIKey | OMXGZAIGKZEXTM-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole?
The IUPAC name of 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole (CID 13078368) is 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole.
What is the SMILES notation for 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole?
The canonical SMILES for 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole is Fc1ccc(C(CCCN2CCC(c3noc4cc(F)ccc34)CC2)c2ccc(F)cc2)cc1.
What is the InChIKey of 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole?
The InChIKey is OMXGZAIGKZEXTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27F3N2O/c29-22-7-3-19(4-8-22)25(20-5-9-23(30)10-6-20)2-1-15-33-16-13-21(14-17-33)28-26-12-11-24(31)18-27(26)34-32-28/h3-12,18,21,25H,1-2,13-17H2.
What are the key properties of 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole?
3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole has a molecular weight of 464.53 g/mol, XLogP of 7.04, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[4,4-bis(4-fluorophenyl)butyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole is sourced from PubChem (CID 13078368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).