About 2-(2-cyclohexylethyl)-2,3-dihydropyran-4-one
2-(2-cyclohexylethyl)-2,3-dihydropyran-4-one (PubChem CID 130785572) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-(2-cyclohexylethyl)-2,3-dihydropyran-4-one.
Molecular Properties
| Compound Name | 2-(2-cyclohexylethyl)-2,3-dihydropyran-4-one |
| PubChem CID | 130785572 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 2-(2-cyclohexylethyl)-2,3-dihydropyran-4-one |
| SMILES | O=C1C=COC(CCC2CCCCC2)C1 |
| InChI | InChI=1S/C13H20O2/c14-12-8-9-15-13(10-12)7-6-11-4-2-1-3-5-11/h8-9,11,13H,1-7,10H2 |
| InChIKey | LJXTUKXDLNYONA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-cyclohexylethyl)-2,3-dihydropyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyclohexylethyl)-2,3-dihydropyran-4-one?
The IUPAC name of 2-(2-cyclohexylethyl)-2,3-dihydropyran-4-one (CID 130785572) is 2-(2-cyclohexylethyl)-2,3-dihydropyran-4-one.
What is the SMILES notation for 2-(2-cyclohexylethyl)-2,3-dihydropyran-4-one?
The canonical SMILES for 2-(2-cyclohexylethyl)-2,3-dihydropyran-4-one is O=C1C=COC(CCC2CCCCC2)C1.
What is the InChIKey of 2-(2-cyclohexylethyl)-2,3-dihydropyran-4-one?
The InChIKey is LJXTUKXDLNYONA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2/c14-12-8-9-15-13(10-12)7-6-11-4-2-1-3-5-11/h8-9,11,13H,1-7,10H2.
What are the key properties of 2-(2-cyclohexylethyl)-2,3-dihydropyran-4-one?
2-(2-cyclohexylethyl)-2,3-dihydropyran-4-one has a molecular weight of 208.30 g/mol, XLogP of 3.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyclohexylethyl)-2,3-dihydropyran-4-one is sourced from PubChem (CID 130785572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).