C11H16N2O — CID 130787810
N-pent-1-yn-3-yl-2-azabicyclo[2.1.1]hexane-5-carboxamide (PubChem CID 130787810) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is N-pent-1-yn-3-yl-2-azabicyclo[2.1.1]hexane-5-carboxamide.
| Compound Name | N-pent-1-yn-3-yl-2-azabicyclo[2.1.1]hexane-5-carboxamide |
|---|---|
| PubChem CID | 130787810 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | N-pent-1-yn-3-yl-2-azabicyclo[2.1.1]hexane-5-carboxamide |
| SMILES | C#CC(CC)NC(=O)C1C2CNC1C2 |
| InChI | InChI=1S/C11H16N2O/c1-3-8(4-2)13-11(14)10-7-5-9(10)12-6-7/h1,7-10,12H,4-6H2,2H3,(H,13,14) |
| InChIKey | UZGWEFCMTMJMNA-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|