C10H7F3S — CID 130788515
2-(difluoromethyl)-5-fluoro-3-methyl-1-benzothiophene (PubChem CID 130788515) has the molecular formula C10H7F3S and a molecular weight of 216.23 g/mol. Its IUPAC name is 2-(difluoromethyl)-5-fluoro-3-methyl-1-benzothiophene.
| Compound Name | 2-(difluoromethyl)-5-fluoro-3-methyl-1-benzothiophene |
|---|---|
| PubChem CID | 130788515 |
| Molecular Formula | C10H7F3S |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 2-(difluoromethyl)-5-fluoro-3-methyl-1-benzothiophene |
| SMILES | Cc1c(C(F)F)sc2ccc(F)cc12 |
| InChI | InChI=1S/C10H7F3S/c1-5-7-4-6(11)2-3-8(7)14-9(5)10(12)13/h2-4,10H,1H3 |
| InChIKey | OUBUFFMVAXBVQL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |