About 5-(2,2-dimethylcyclopropyl)-1-ethyl-4-methylimidazol-2-amine
5-(2,2-dimethylcyclopropyl)-1-ethyl-4-methylimidazol-2-amine (PubChem CID 130791618) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 5-(2,2-dimethylcyclopropyl)-1-ethyl-4-methylimidazol-2-amine.
Molecular Properties
| Compound Name | 5-(2,2-dimethylcyclopropyl)-1-ethyl-4-methylimidazol-2-amine |
| PubChem CID | 130791618 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 5-(2,2-dimethylcyclopropyl)-1-ethyl-4-methylimidazol-2-amine |
| SMILES | CCn1c(N)nc(C)c1C1CC1(C)C |
| InChI | InChI=1S/C11H19N3/c1-5-14-9(7(2)13-10(14)12)8-6-11(8,3)4/h8H,5-6H2,1-4H3,(H2,12,13) |
| InChIKey | JYIYFBLFBGJTRU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2,2-dimethylcyclopropyl)-1-ethyl-4-methylimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-dimethylcyclopropyl)-1-ethyl-4-methylimidazol-2-amine?
The IUPAC name of 5-(2,2-dimethylcyclopropyl)-1-ethyl-4-methylimidazol-2-amine (CID 130791618) is 5-(2,2-dimethylcyclopropyl)-1-ethyl-4-methylimidazol-2-amine.
What is the SMILES notation for 5-(2,2-dimethylcyclopropyl)-1-ethyl-4-methylimidazol-2-amine?
The canonical SMILES for 5-(2,2-dimethylcyclopropyl)-1-ethyl-4-methylimidazol-2-amine is CCn1c(N)nc(C)c1C1CC1(C)C.
What is the InChIKey of 5-(2,2-dimethylcyclopropyl)-1-ethyl-4-methylimidazol-2-amine?
The InChIKey is JYIYFBLFBGJTRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3/c1-5-14-9(7(2)13-10(14)12)8-6-11(8,3)4/h8H,5-6H2,1-4H3,(H2,12,13).
What are the key properties of 5-(2,2-dimethylcyclopropyl)-1-ethyl-4-methylimidazol-2-amine?
5-(2,2-dimethylcyclopropyl)-1-ethyl-4-methylimidazol-2-amine has a molecular weight of 193.29 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dimethylcyclopropyl)-1-ethyl-4-methylimidazol-2-amine is sourced from PubChem (CID 130791618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).