About 1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-3-one
1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-3-one (PubChem CID 130791845) has the molecular formula C10H9N3OS
and a molecular weight of 219.27 g/mol. Its IUPAC name is 1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-3-one.
Molecular Properties
| Compound Name | 1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-3-one |
| PubChem CID | 130791845 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-3-one |
| SMILES | O=C1CCN(c2ncc3sccc3n2)C1 |
| InChI | InChI=1S/C10H9N3OS/c14-7-1-3-13(6-7)10-11-5-9-8(12-10)2-4-15-9/h2,4-5H,1,3,6H2 |
| InChIKey | RFCPUVITTXWLEV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-3-one?
The IUPAC name of 1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-3-one (CID 130791845) is 1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-3-one.
What is the SMILES notation for 1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-3-one?
The canonical SMILES for 1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-3-one is O=C1CCN(c2ncc3sccc3n2)C1.
What is the InChIKey of 1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-3-one?
The InChIKey is RFCPUVITTXWLEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3OS/c14-7-1-3-13(6-7)10-11-5-9-8(12-10)2-4-15-9/h2,4-5H,1,3,6H2.
What are the key properties of 1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-3-one?
1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-3-one has a molecular weight of 219.27 g/mol, XLogP of 1.47, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-thieno[3,2-d]pyrimidin-2-ylpyrrolidin-3-one is sourced from PubChem (CID 130791845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).