C9H17NO3S — CID 130791964
2,6-dimethyl-4-[[(2R)-oxiran-2-yl]methyl]-1,4-thiazinane 1,1-dioxide (PubChem CID 130791964) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 2,6-dimethyl-4-[[(2R)-oxiran-2-yl]methyl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 2,6-dimethyl-4-[[(2R)-oxiran-2-yl]methyl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 130791964 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2,6-dimethyl-4-[[(2R)-oxiran-2-yl]methyl]-1,4-thiazinane 1,1-dioxide |
| SMILES | CC1CN(C[C@@H]2CO2)CC(C)S1(=O)=O |
| InChI | InChI=1S/C9H17NO3S/c1-7-3-10(5-9-6-13-9)4-8(2)14(7,11)12/h7-9H,3-6H2,1-2H3/t7?,8?,9-/m1/s1 |
| InChIKey | HPDGTGVBJGJYOI-AMDVSUOASA-N |
| XLogP | -0.11 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|