(1R)-7-fluoro-2,3-dihydro-1H-isoindole-1-carboxylic acid

C9H8FNO2 — CID 130802968

IUPAC(1R)-7-fluoro-2,3-dihydro-1H-isoindole-1-carboxylic acid
SMILESO=C(O)[C@@H]1NCc2cccc(F)c21
InChIInChI=1S/C9H8FNO2/c10-6-3-1-2-5-4-11-8(7(5)6)9(12)13/h1-3,8,11H,4H2,(H,12,13)/t8-/m1/s1
InChIKeyQBSXGJBQIQPXJT-MRVPVSSYSA-N
MW181.17 g/mol
LogP1.05
Rot. Bonds1

About (1R)-7-fluoro-2,3-dihydro-1H-isoindole-1-carboxylic acid

(1R)-7-fluoro-2,3-dihydro-1H-isoindole-1-carboxylic acid (PubChem CID 130802968) has the molecular formula C9H8FNO2 and a molecular weight of 181.17 g/mol. Its IUPAC name is (1R)-7-fluoro-2,3-dihydro-1H-isoindole-1-carboxylic acid.

Molecular Properties

Compound Name(1R)-7-fluoro-2,3-dihydro-1H-isoindole-1-carboxylic acid
PubChem CID130802968
Molecular FormulaC9H8FNO2
Molecular Weight181.17 g/mol
Exact Mass181.05
IUPAC Name(1R)-7-fluoro-2,3-dihydro-1H-isoindole-1-carboxylic acid
SMILESO=C(O)[C@@H]1NCc2cccc(F)c21
InChIInChI=1S/C9H8FNO2/c10-6-3-1-2-5-4-11-8(7(5)6)9(12)13/h1-3,8,11H,4H2,(H,12,13)/t8-/m1/s1
InChIKeyQBSXGJBQIQPXJT-MRVPVSSYSA-N
XLogP1.05
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.17
LogP ≤ 51.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (1R)-7-fluoro-2,3-dihydro-1H-isoindole-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1R)-7-fluoro-2,3-dihydro-1H-isoindole-1-carboxylic acid?
The IUPAC name of (1R)-7-fluoro-2,3-dihydro-1H-isoindole-1-carboxylic acid (CID 130802968) is (1R)-7-fluoro-2,3-dihydro-1H-isoindole-1-carboxylic acid.
What is the SMILES notation for (1R)-7-fluoro-2,3-dihydro-1H-isoindole-1-carboxylic acid?
The canonical SMILES for (1R)-7-fluoro-2,3-dihydro-1H-isoindole-1-carboxylic acid is O=C(O)[C@@H]1NCc2cccc(F)c21.
What is the InChIKey of (1R)-7-fluoro-2,3-dihydro-1H-isoindole-1-carboxylic acid?
The InChIKey is QBSXGJBQIQPXJT-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H8FNO2/c10-6-3-1-2-5-4-11-8(7(5)6)9(12)13/h1-3,8,11H,4H2,(H,12,13)/t8-/m1/s1.
What are the key properties of (1R)-7-fluoro-2,3-dihydro-1H-isoindole-1-carboxylic acid?
(1R)-7-fluoro-2,3-dihydro-1H-isoindole-1-carboxylic acid has a molecular weight of 181.17 g/mol, XLogP of 1.05, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-7-fluoro-2,3-dihydro-1H-isoindole-1-carboxylic acid is sourced from PubChem (CID 130802968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).