C7H12O5 — CID 130803122
5-[(1S,2S)-1,2,3-trihydroxypropyl]oxolan-2-one (PubChem CID 130803122) has the molecular formula C7H12O5 and a molecular weight of 176.17 g/mol. Its IUPAC name is 5-[(1S,2S)-1,2,3-trihydroxypropyl]oxolan-2-one.
| Compound Name | 5-[(1S,2S)-1,2,3-trihydroxypropyl]oxolan-2-one |
|---|---|
| PubChem CID | 130803122 |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 5-[(1S,2S)-1,2,3-trihydroxypropyl]oxolan-2-one |
| SMILES | O=C1CCC([C@@H](O)[C@@H](O)CO)O1 |
| InChI | InChI=1S/C7H12O5/c8-3-4(9)7(11)5-1-2-6(10)12-5/h4-5,7-9,11H,1-3H2/t4-,5?,7-/m0/s1 |
| InChIKey | UUCZNBCOKXSKLU-VZWBMFKNSA-N |
| XLogP | -1.59 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |