About 7-sulfanyl-1-benzothiophene-3,5-diol
7-sulfanyl-1-benzothiophene-3,5-diol (PubChem CID 130803540) has the molecular formula C8H6O2S2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 7-sulfanyl-1-benzothiophene-3,5-diol.
Molecular Properties
| Compound Name | 7-sulfanyl-1-benzothiophene-3,5-diol |
| PubChem CID | 130803540 |
| Molecular Formula | C8H6O2S2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 197.98 |
| IUPAC Name | 7-sulfanyl-1-benzothiophene-3,5-diol |
| SMILES | Oc1cc(S)c2scc(O)c2c1 |
| InChI | InChI=1S/C8H6O2S2/c9-4-1-5-6(10)3-12-8(5)7(11)2-4/h1-3,9-11H |
| InChIKey | UNXDFNIDKDSBEC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 7-sulfanyl-1-benzothiophene-3,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-sulfanyl-1-benzothiophene-3,5-diol?
The IUPAC name of 7-sulfanyl-1-benzothiophene-3,5-diol (CID 130803540) is 7-sulfanyl-1-benzothiophene-3,5-diol.
What is the SMILES notation for 7-sulfanyl-1-benzothiophene-3,5-diol?
The canonical SMILES for 7-sulfanyl-1-benzothiophene-3,5-diol is Oc1cc(S)c2scc(O)c2c1.
What is the InChIKey of 7-sulfanyl-1-benzothiophene-3,5-diol?
The InChIKey is UNXDFNIDKDSBEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2S2/c9-4-1-5-6(10)3-12-8(5)7(11)2-4/h1-3,9-11H.
What are the key properties of 7-sulfanyl-1-benzothiophene-3,5-diol?
7-sulfanyl-1-benzothiophene-3,5-diol has a molecular weight of 198.27 g/mol, XLogP of 2.60, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-sulfanyl-1-benzothiophene-3,5-diol is sourced from PubChem (CID 130803540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).