C11H19NO2 — CID 130804461
2-[[(2R)-oxiran-2-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 130804461) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-[[(2R)-oxiran-2-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | 2-[[(2R)-oxiran-2-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 130804461 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-[[(2R)-oxiran-2-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | OC1CCC2CN(C[C@@H]3CO3)CC2C1 |
| InChI | InChI=1S/C11H19NO2/c13-10-2-1-8-4-12(5-9(8)3-10)6-11-7-14-11/h8-11,13H,1-7H2/t8?,9?,10?,11-/m1/s1 |
| InChIKey | RAMQMGMQZKKSSC-AHELAYONSA-N |
| XLogP | 0.48 |
| TPSA | 36.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|