C9H11NO3 — CID 130804717
(4R)-4-(5-methylfuran-2-yl)-1,3-oxazinan-2-one (PubChem CID 130804717) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is (4R)-4-(5-methylfuran-2-yl)-1,3-oxazinan-2-one.
| Compound Name | (4R)-4-(5-methylfuran-2-yl)-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 130804717 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | (4R)-4-(5-methylfuran-2-yl)-1,3-oxazinan-2-one |
| SMILES | Cc1ccc([C@H]2CCOC(=O)N2)o1 |
| InChI | InChI=1S/C9H11NO3/c1-6-2-3-8(13-6)7-4-5-12-9(11)10-7/h2-3,7H,4-5H2,1H3,(H,10,11)/t7-/m1/s1 |
| InChIKey | YGOXEIIUOXAQIO-SSDOTTSWSA-N |
| XLogP | 1.76 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |