C6H9NO5 — CID 130804912
(3aS,6R,7S,7aR)-6,7-dihydroxy-3,3a,5,6,7,7a-hexahydropyrano[2,3-d][1,3]oxazol-2-one (PubChem CID 130804912) has the molecular formula C6H9NO5 and a molecular weight of 175.14 g/mol. Its IUPAC name is (3aS,6R,7S,7aR)-6,7-dihydroxy-3,3a,5,6,7,7a-hexahydropyrano[2,3-d][1,3]oxazol-2-one.
| Compound Name | (3aS,6R,7S,7aR)-6,7-dihydroxy-3,3a,5,6,7,7a-hexahydropyrano[2,3-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 130804912 |
| Molecular Formula | C6H9NO5 |
| Molecular Weight | 175.14 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | (3aS,6R,7S,7aR)-6,7-dihydroxy-3,3a,5,6,7,7a-hexahydropyrano[2,3-d][1,3]oxazol-2-one |
| SMILES | O=C1N[C@H]2OC[C@@H](O)[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C6H9NO5/c8-2-1-11-5-4(3(2)9)12-6(10)7-5/h2-5,8-9H,1H2,(H,7,10)/t2-,3+,4-,5+/m1/s1 |
| InChIKey | NGGRTAGJJCEQOG-LECHCGJUSA-N |
| XLogP | -1.83 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.14 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |