C10H12O2 — CID 130804975
(1aR,3aS,7bS)-2,3,3a,4,5,7b-hexahydro-1aH-naphtho[1,2-b]oxiren-6-one (PubChem CID 130804975) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (1aR,3aS,7bS)-2,3,3a,4,5,7b-hexahydro-1aH-naphtho[1,2-b]oxiren-6-one.
| Compound Name | (1aR,3aS,7bS)-2,3,3a,4,5,7b-hexahydro-1aH-naphtho[1,2-b]oxiren-6-one |
|---|---|
| PubChem CID | 130804975 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (1aR,3aS,7bS)-2,3,3a,4,5,7b-hexahydro-1aH-naphtho[1,2-b]oxiren-6-one |
| SMILES | O=C1C=C2[C@H](CC1)CC[C@H]1O[C@@H]21 |
| InChI | InChI=1S/C10H12O2/c11-7-3-1-6-2-4-9-10(12-9)8(6)5-7/h5-6,9-10H,1-4H2/t6-,9-,10+/m1/s1 |
| InChIKey | KWDJCLBTRFYZFA-DRTBCBBWSA-N |
| XLogP | 1.45 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|