About 3-bromo-2-[bromo-[(1R,2R)-2-ethylcyclopropyl]methyl]-5-methylthiophene
3-bromo-2-[bromo-[(1R,2R)-2-ethylcyclopropyl]methyl]-5-methylthiophene (PubChem CID 130805080) has the molecular formula C11H14Br2S
and a molecular weight of 338.11 g/mol. Its IUPAC name is 3-bromo-2-[bromo-[(1R,2R)-2-ethylcyclopropyl]methyl]-5-methylthiophene.
Molecular Properties
| Compound Name | 3-bromo-2-[bromo-[(1R,2R)-2-ethylcyclopropyl]methyl]-5-methylthiophene |
| PubChem CID | 130805080 |
| Molecular Formula | C11H14Br2S |
| Molecular Weight | 338.11 g/mol |
| Exact Mass | 335.92 |
| IUPAC Name | 3-bromo-2-[bromo-[(1R,2R)-2-ethylcyclopropyl]methyl]-5-methylthiophene |
| SMILES | CC[C@@H]1C[C@H]1C(Br)c1sc(C)cc1Br |
| InChI | InChI=1S/C11H14Br2S/c1-3-7-5-8(7)10(13)11-9(12)4-6(2)14-11/h4,7-8,10H,3,5H2,1-2H3/t7-,8-,10?/m1/s1 |
| InChIKey | BDSLDHYTCLAGHG-SZBHIRRCSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.11 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-[bromo-[(1R,2R)-2-ethylcyclopropyl]methyl]-5-methylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-[bromo-[(1R,2R)-2-ethylcyclopropyl]methyl]-5-methylthiophene?
The IUPAC name of 3-bromo-2-[bromo-[(1R,2R)-2-ethylcyclopropyl]methyl]-5-methylthiophene (CID 130805080) is 3-bromo-2-[bromo-[(1R,2R)-2-ethylcyclopropyl]methyl]-5-methylthiophene.
What is the SMILES notation for 3-bromo-2-[bromo-[(1R,2R)-2-ethylcyclopropyl]methyl]-5-methylthiophene?
The canonical SMILES for 3-bromo-2-[bromo-[(1R,2R)-2-ethylcyclopropyl]methyl]-5-methylthiophene is CC[C@@H]1C[C@H]1C(Br)c1sc(C)cc1Br.
What is the InChIKey of 3-bromo-2-[bromo-[(1R,2R)-2-ethylcyclopropyl]methyl]-5-methylthiophene?
The InChIKey is BDSLDHYTCLAGHG-SZBHIRRCSA-N. The full InChI is InChI=1S/C11H14Br2S/c1-3-7-5-8(7)10(13)11-9(12)4-6(2)14-11/h4,7-8,10H,3,5H2,1-2H3/t7-,8-,10?/m1/s1.
What are the key properties of 3-bromo-2-[bromo-[(1R,2R)-2-ethylcyclopropyl]methyl]-5-methylthiophene?
3-bromo-2-[bromo-[(1R,2R)-2-ethylcyclopropyl]methyl]-5-methylthiophene has a molecular weight of 338.11 g/mol, XLogP of 5.30, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-[bromo-[(1R,2R)-2-ethylcyclopropyl]methyl]-5-methylthiophene is sourced from PubChem (CID 130805080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).