About 3-(5-methyl-1,4-thiazepan-4-yl)pentanenitrile
3-(5-methyl-1,4-thiazepan-4-yl)pentanenitrile (PubChem CID 130805125) has the molecular formula C11H20N2S
and a molecular weight of 212.36 g/mol. Its IUPAC name is 3-(5-methyl-1,4-thiazepan-4-yl)pentanenitrile.
Molecular Properties
| Compound Name | 3-(5-methyl-1,4-thiazepan-4-yl)pentanenitrile |
| PubChem CID | 130805125 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 3-(5-methyl-1,4-thiazepan-4-yl)pentanenitrile |
| SMILES | CCC(CC#N)N1CCSCCC1C |
| InChI | InChI=1S/C11H20N2S/c1-3-11(4-6-12)13-7-9-14-8-5-10(13)2/h10-11H,3-5,7-9H2,1-2H3 |
| InChIKey | ZNLKGQBGMKNKAA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-methyl-1,4-thiazepan-4-yl)pentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methyl-1,4-thiazepan-4-yl)pentanenitrile?
The IUPAC name of 3-(5-methyl-1,4-thiazepan-4-yl)pentanenitrile (CID 130805125) is 3-(5-methyl-1,4-thiazepan-4-yl)pentanenitrile.
What is the SMILES notation for 3-(5-methyl-1,4-thiazepan-4-yl)pentanenitrile?
The canonical SMILES for 3-(5-methyl-1,4-thiazepan-4-yl)pentanenitrile is CCC(CC#N)N1CCSCCC1C.
What is the InChIKey of 3-(5-methyl-1,4-thiazepan-4-yl)pentanenitrile?
The InChIKey is ZNLKGQBGMKNKAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2S/c1-3-11(4-6-12)13-7-9-14-8-5-10(13)2/h10-11H,3-5,7-9H2,1-2H3.
What are the key properties of 3-(5-methyl-1,4-thiazepan-4-yl)pentanenitrile?
3-(5-methyl-1,4-thiazepan-4-yl)pentanenitrile has a molecular weight of 212.36 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methyl-1,4-thiazepan-4-yl)pentanenitrile is sourced from PubChem (CID 130805125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).