About 1-cyclopropyl-2-(6-methyl-2-pyridinyl)ethane-1,2-diamine
1-cyclopropyl-2-(6-methyl-2-pyridinyl)ethane-1,2-diamine (PubChem CID 130806046) has the molecular formula C11H17N3
and a molecular weight of 191.28 g/mol. Its IUPAC name is 1-cyclopropyl-2-(6-methyl-2-pyridinyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-cyclopropyl-2-(6-methyl-2-pyridinyl)ethane-1,2-diamine |
| PubChem CID | 130806046 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 1-cyclopropyl-2-(6-methyl-2-pyridinyl)ethane-1,2-diamine |
| SMILES | Cc1cccc(C(N)C(N)C2CC2)n1 |
| InChI | InChI=1S/C11H17N3/c1-7-3-2-4-9(14-7)11(13)10(12)8-5-6-8/h2-4,8,10-11H,5-6,12-13H2,1H3 |
| InChIKey | CWENOZBPHPPIKK-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopropyl-2-(6-methyl-2-pyridinyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2-(6-methyl-2-pyridinyl)ethane-1,2-diamine?
The IUPAC name of 1-cyclopropyl-2-(6-methyl-2-pyridinyl)ethane-1,2-diamine (CID 130806046) is 1-cyclopropyl-2-(6-methyl-2-pyridinyl)ethane-1,2-diamine.
What is the SMILES notation for 1-cyclopropyl-2-(6-methyl-2-pyridinyl)ethane-1,2-diamine?
The canonical SMILES for 1-cyclopropyl-2-(6-methyl-2-pyridinyl)ethane-1,2-diamine is Cc1cccc(C(N)C(N)C2CC2)n1.
What is the InChIKey of 1-cyclopropyl-2-(6-methyl-2-pyridinyl)ethane-1,2-diamine?
The InChIKey is CWENOZBPHPPIKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3/c1-7-3-2-4-9(14-7)11(13)10(12)8-5-6-8/h2-4,8,10-11H,5-6,12-13H2,1H3.
What are the key properties of 1-cyclopropyl-2-(6-methyl-2-pyridinyl)ethane-1,2-diamine?
1-cyclopropyl-2-(6-methyl-2-pyridinyl)ethane-1,2-diamine has a molecular weight of 191.28 g/mol, XLogP of 1.13, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2-(6-methyl-2-pyridinyl)ethane-1,2-diamine is sourced from PubChem (CID 130806046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).