About 1-(5-piperazin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine
1-(5-piperazin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine (PubChem CID 130806084) has the molecular formula C8H15N5O
and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-(5-piperazin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine.
Molecular Properties
| Compound Name | 1-(5-piperazin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine |
| PubChem CID | 130806084 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 1-(5-piperazin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine |
| SMILES | CC(N)c1nnc(C2CNCCN2)o1 |
| InChI | InChI=1S/C8H15N5O/c1-5(9)7-12-13-8(14-7)6-4-10-2-3-11-6/h5-6,10-11H,2-4,9H2,1H3 |
| InChIKey | QBFMATFIIRKULM-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(5-piperazin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-piperazin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine?
The IUPAC name of 1-(5-piperazin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine (CID 130806084) is 1-(5-piperazin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine.
What is the SMILES notation for 1-(5-piperazin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine?
The canonical SMILES for 1-(5-piperazin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine is CC(N)c1nnc(C2CNCCN2)o1.
What is the InChIKey of 1-(5-piperazin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine?
The InChIKey is QBFMATFIIRKULM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N5O/c1-5(9)7-12-13-8(14-7)6-4-10-2-3-11-6/h5-6,10-11H,2-4,9H2,1H3.
What are the key properties of 1-(5-piperazin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine?
1-(5-piperazin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine has a molecular weight of 197.24 g/mol, XLogP of -0.68, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-piperazin-2-yl-1,3,4-oxadiazol-2-yl)ethanamine is sourced from PubChem (CID 130806084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).