About (1R,2S)-1-(6-bromo-2-pyridinyl)propane-1,2-diamine
(1R,2S)-1-(6-bromo-2-pyridinyl)propane-1,2-diamine (PubChem CID 130806151) has the molecular formula C8H12BrN3
and a molecular weight of 230.11 g/mol. Its IUPAC name is (1R,2S)-1-(6-bromo-2-pyridinyl)propane-1,2-diamine.
Molecular Properties
| Compound Name | (1R,2S)-1-(6-bromo-2-pyridinyl)propane-1,2-diamine |
| PubChem CID | 130806151 |
| Molecular Formula | C8H12BrN3 |
| Molecular Weight | 230.11 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | (1R,2S)-1-(6-bromo-2-pyridinyl)propane-1,2-diamine |
| SMILES | C[C@H](N)[C@@H](N)c1cccc(Br)n1 |
| InChI | InChI=1S/C8H12BrN3/c1-5(10)8(11)6-3-2-4-7(9)12-6/h2-5,8H,10-11H2,1H3/t5-,8+/m0/s1 |
| InChIKey | KEEUFVCVSHYLQQ-YLWLKBPMSA-N |
| XLogP | 1.19 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.11 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (1R,2S)-1-(6-bromo-2-pyridinyl)propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-1-(6-bromo-2-pyridinyl)propane-1,2-diamine?
The IUPAC name of (1R,2S)-1-(6-bromo-2-pyridinyl)propane-1,2-diamine (CID 130806151) is (1R,2S)-1-(6-bromo-2-pyridinyl)propane-1,2-diamine.
What is the SMILES notation for (1R,2S)-1-(6-bromo-2-pyridinyl)propane-1,2-diamine?
The canonical SMILES for (1R,2S)-1-(6-bromo-2-pyridinyl)propane-1,2-diamine is C[C@H](N)[C@@H](N)c1cccc(Br)n1.
What is the InChIKey of (1R,2S)-1-(6-bromo-2-pyridinyl)propane-1,2-diamine?
The InChIKey is KEEUFVCVSHYLQQ-YLWLKBPMSA-N. The full InChI is InChI=1S/C8H12BrN3/c1-5(10)8(11)6-3-2-4-7(9)12-6/h2-5,8H,10-11H2,1H3/t5-,8+/m0/s1.
What are the key properties of (1R,2S)-1-(6-bromo-2-pyridinyl)propane-1,2-diamine?
(1R,2S)-1-(6-bromo-2-pyridinyl)propane-1,2-diamine has a molecular weight of 230.11 g/mol, XLogP of 1.19, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-1-(6-bromo-2-pyridinyl)propane-1,2-diamine is sourced from PubChem (CID 130806151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).