C8H16O2Si — CID 130806955
(2R,3R)-5-trimethylsilylpent-4-yne-2,3-diol (PubChem CID 130806955) has the molecular formula C8H16O2Si and a molecular weight of 172.30 g/mol. Its IUPAC name is (2R,3R)-5-trimethylsilylpent-4-yne-2,3-diol.
| Compound Name | (2R,3R)-5-trimethylsilylpent-4-yne-2,3-diol |
|---|---|
| PubChem CID | 130806955 |
| Molecular Formula | C8H16O2Si |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | (2R,3R)-5-trimethylsilylpent-4-yne-2,3-diol |
| SMILES | C[C@@H](O)[C@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C8H16O2Si/c1-7(9)8(10)5-6-11(2,3)4/h7-10H,1-4H3/t7-,8-/m1/s1 |
| InChIKey | AQAYEIYXNAPNCQ-HTQZYQBOSA-N |
| XLogP | 0.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|