C7H14N2O2 — CID 130808649
N-methoxy-N,3-dimethylazetidine-3-carboxamide (PubChem CID 130808649) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is N-methoxy-N,3-dimethylazetidine-3-carboxamide.
| Compound Name | N-methoxy-N,3-dimethylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 130808649 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | N-methoxy-N,3-dimethylazetidine-3-carboxamide |
| SMILES | CON(C)C(=O)C1(C)CNC1 |
| InChI | InChI=1S/C7H14N2O2/c1-7(4-8-5-7)6(10)9(2)11-3/h8H,4-5H2,1-3H3 |
| InChIKey | MJSXEZLKXWOTMQ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|