C10H19ClN2O — CID 130809222
(4-amino-4-methylpiperidin-1-yl)-cyclopropylmethanone;hydrochloride (PubChem CID 130809222) has the molecular formula C10H19ClN2O and a molecular weight of 218.73 g/mol. Its IUPAC name is (4-amino-4-methylpiperidin-1-yl)-cyclopropylmethanone;hydrochloride.
| Compound Name | (4-amino-4-methylpiperidin-1-yl)-cyclopropylmethanone;hydrochloride |
|---|---|
| PubChem CID | 130809222 |
| Molecular Formula | C10H19ClN2O |
| Molecular Weight | 218.73 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | (4-amino-4-methylpiperidin-1-yl)-cyclopropylmethanone;hydrochloride |
| SMILES | CC1(N)CCN(C(=O)C2CC2)CC1.Cl |
| InChI | InChI=1S/C10H18N2O.ClH/c1-10(11)4-6-12(7-5-10)9(13)8-2-3-8;/h8H,2-7,11H2,1H3;1H |
| InChIKey | GFXXARGTLLGWLK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.73 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |