C11H23N3 — CID 13081047
(2E,4E)-1-N,1-N,1-N',1-N',5-N,5-N-hexamethylpenta-2,4-diene-1,1,5-triamine (PubChem CID 13081047) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is (2E,4E)-1-N,1-N,1-N',1-N',5-N,5-N-hexamethylpenta-2,4-diene-1,1,5-triamine.
| Compound Name | (2E,4E)-1-N,1-N,1-N',1-N',5-N,5-N-hexamethylpenta-2,4-diene-1,1,5-triamine |
|---|---|
| PubChem CID | 13081047 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | (2E,4E)-1-N,1-N,1-N',1-N',5-N,5-N-hexamethylpenta-2,4-diene-1,1,5-triamine |
| SMILES | CN(C)/C=C/C=C/C(N(C)C)N(C)C |
| InChI | InChI=1S/C11H23N3/c1-12(2)10-8-7-9-11(13(3)4)14(5)6/h7-11H,1-6H3/b9-7+,10-8+ |
| InChIKey | PYLGDVVZCFDRAN-FIFLTTCUSA-N |
| XLogP | 1.07 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|