C13H18N2O — CID 13081391
8-methyl-1,2,3,4,6,7,8,9-octahydropyrido[2,1-b]quinazolin-11-one (PubChem CID 13081391) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 8-methyl-1,2,3,4,6,7,8,9-octahydropyrido[2,1-b]quinazolin-11-one.
| Compound Name | 8-methyl-1,2,3,4,6,7,8,9-octahydropyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 13081391 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 8-methyl-1,2,3,4,6,7,8,9-octahydropyrido[2,1-b]quinazolin-11-one |
| SMILES | CC1CCc2nc3c(c(=O)n2C1)CCCC3 |
| InChI | InChI=1S/C13H18N2O/c1-9-6-7-12-14-11-5-3-2-4-10(11)13(16)15(12)8-9/h9H,2-8H2,1H3 |
| InChIKey | QYDQDJCFRRWDJV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |