C17H23NO2 — CID 13081458
tert-butyl (2R)-2-[(E)-2-phenylethenyl]pyrrolidine-1-carboxylate (PubChem CID 13081458) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(E)-2-phenylethenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(E)-2-phenylethenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 13081458 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | tert-butyl (2R)-2-[(E)-2-phenylethenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H23NO2/c1-17(2,3)20-16(19)18-13-7-10-15(18)12-11-14-8-5-4-6-9-14/h4-6,8-9,11-12,15H,7,10,13H2,1-3H3/b12-11+/t15-/m1/s1 |
| InChIKey | JFLBTLCVLDWTIG-AYJWMTRPSA-N |
| XLogP | 4.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |