C8H7IN2OS2 — CID 130815157
1-(5-iodothiophen-3-yl)-2-(1,2,5-thiadiazol-3-yl)ethanol (PubChem CID 130815157) has the molecular formula C8H7IN2OS2 and a molecular weight of 338.20 g/mol. Its IUPAC name is 1-(5-iodothiophen-3-yl)-2-(1,2,5-thiadiazol-3-yl)ethanol.
| Compound Name | 1-(5-iodothiophen-3-yl)-2-(1,2,5-thiadiazol-3-yl)ethanol |
|---|---|
| PubChem CID | 130815157 |
| Molecular Formula | C8H7IN2OS2 |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.90 |
| IUPAC Name | 1-(5-iodothiophen-3-yl)-2-(1,2,5-thiadiazol-3-yl)ethanol |
| SMILES | OC(Cc1cnsn1)c1csc(I)c1 |
| InChI | InChI=1S/C8H7IN2OS2/c9-8-1-5(4-13-8)7(12)2-6-3-10-14-11-6/h1,3-4,7,12H,2H2 |
| InChIKey | SXRJBXUUTHUZJM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|