About 5-[(2S,5S)-5-methylmorpholin-2-yl]pyridin-2-amine
5-[(2S,5S)-5-methylmorpholin-2-yl]pyridin-2-amine (PubChem CID 130816094) has the molecular formula C10H15N3O
and a molecular weight of 193.25 g/mol. Its IUPAC name is 5-[(2S,5S)-5-methylmorpholin-2-yl]pyridin-2-amine.
Molecular Properties
| Compound Name | 5-[(2S,5S)-5-methylmorpholin-2-yl]pyridin-2-amine |
| PubChem CID | 130816094 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 5-[(2S,5S)-5-methylmorpholin-2-yl]pyridin-2-amine |
| SMILES | C[C@H]1CO[C@@H](c2ccc(N)nc2)CN1 |
| InChI | InChI=1S/C10H15N3O/c1-7-6-14-9(5-12-7)8-2-3-10(11)13-4-8/h2-4,7,9,12H,5-6H2,1H3,(H2,11,13)/t7-,9+/m0/s1 |
| InChIKey | UXRVFSIWSWPXSI-IONNQARKSA-N |
| XLogP | 0.71 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(2S,5S)-5-methylmorpholin-2-yl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2S,5S)-5-methylmorpholin-2-yl]pyridin-2-amine?
The IUPAC name of 5-[(2S,5S)-5-methylmorpholin-2-yl]pyridin-2-amine (CID 130816094) is 5-[(2S,5S)-5-methylmorpholin-2-yl]pyridin-2-amine.
What is the SMILES notation for 5-[(2S,5S)-5-methylmorpholin-2-yl]pyridin-2-amine?
The canonical SMILES for 5-[(2S,5S)-5-methylmorpholin-2-yl]pyridin-2-amine is C[C@H]1CO[C@@H](c2ccc(N)nc2)CN1.
What is the InChIKey of 5-[(2S,5S)-5-methylmorpholin-2-yl]pyridin-2-amine?
The InChIKey is UXRVFSIWSWPXSI-IONNQARKSA-N. The full InChI is InChI=1S/C10H15N3O/c1-7-6-14-9(5-12-7)8-2-3-10(11)13-4-8/h2-4,7,9,12H,5-6H2,1H3,(H2,11,13)/t7-,9+/m0/s1.
What are the key properties of 5-[(2S,5S)-5-methylmorpholin-2-yl]pyridin-2-amine?
5-[(2S,5S)-5-methylmorpholin-2-yl]pyridin-2-amine has a molecular weight of 193.25 g/mol, XLogP of 0.71, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2S,5S)-5-methylmorpholin-2-yl]pyridin-2-amine is sourced from PubChem (CID 130816094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).