About 2-(3,3-dimethylbutyl)-3,5-dimethylpiperidine
2-(3,3-dimethylbutyl)-3,5-dimethylpiperidine (PubChem CID 130816302) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is 2-(3,3-dimethylbutyl)-3,5-dimethylpiperidine.
Molecular Properties
| Compound Name | 2-(3,3-dimethylbutyl)-3,5-dimethylpiperidine |
| PubChem CID | 130816302 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | 2-(3,3-dimethylbutyl)-3,5-dimethylpiperidine |
| SMILES | CC1CNC(CCC(C)(C)C)C(C)C1 |
| InChI | InChI=1S/C13H27N/c1-10-8-11(2)12(14-9-10)6-7-13(3,4)5/h10-12,14H,6-9H2,1-5H3 |
| InChIKey | GURFZHZGRJIDRN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3,3-dimethylbutyl)-3,5-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethylbutyl)-3,5-dimethylpiperidine?
The IUPAC name of 2-(3,3-dimethylbutyl)-3,5-dimethylpiperidine (CID 130816302) is 2-(3,3-dimethylbutyl)-3,5-dimethylpiperidine.
What is the SMILES notation for 2-(3,3-dimethylbutyl)-3,5-dimethylpiperidine?
The canonical SMILES for 2-(3,3-dimethylbutyl)-3,5-dimethylpiperidine is CC1CNC(CCC(C)(C)C)C(C)C1.
What is the InChIKey of 2-(3,3-dimethylbutyl)-3,5-dimethylpiperidine?
The InChIKey is GURFZHZGRJIDRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N/c1-10-8-11(2)12(14-9-10)6-7-13(3,4)5/h10-12,14H,6-9H2,1-5H3.
What are the key properties of 2-(3,3-dimethylbutyl)-3,5-dimethylpiperidine?
2-(3,3-dimethylbutyl)-3,5-dimethylpiperidine has a molecular weight of 197.37 g/mol, XLogP of 3.45, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethylbutyl)-3,5-dimethylpiperidine is sourced from PubChem (CID 130816302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).