C10H5N3S — CID 130817005
3-amino-1-benzothiophene-4,7-dicarbonitrile (PubChem CID 130817005) has the molecular formula C10H5N3S and a molecular weight of 199.24 g/mol. Its IUPAC name is 3-amino-1-benzothiophene-4,7-dicarbonitrile.
| Compound Name | 3-amino-1-benzothiophene-4,7-dicarbonitrile |
|---|---|
| PubChem CID | 130817005 |
| Molecular Formula | C10H5N3S |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | 3-amino-1-benzothiophene-4,7-dicarbonitrile |
| SMILES | N#Cc1ccc(C#N)c2c(N)csc12 |
| InChI | InChI=1S/C10H5N3S/c11-3-6-1-2-7(4-12)10-9(6)8(13)5-14-10/h1-2,5H,13H2 |
| InChIKey | RIWDSIYYZQWNFN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |