C10H4N2S2 — CID 130817031
4-sulfanyl-1-benzothiophene-3,5-dicarbonitrile (PubChem CID 130817031) has the molecular formula C10H4N2S2 and a molecular weight of 216.29 g/mol. Its IUPAC name is 4-sulfanyl-1-benzothiophene-3,5-dicarbonitrile.
| Compound Name | 4-sulfanyl-1-benzothiophene-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 130817031 |
| Molecular Formula | C10H4N2S2 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | 4-sulfanyl-1-benzothiophene-3,5-dicarbonitrile |
| SMILES | N#Cc1ccc2scc(C#N)c2c1S |
| InChI | InChI=1S/C10H4N2S2/c11-3-6-1-2-8-9(10(6)13)7(4-12)5-14-8/h1-2,5,13H |
| InChIKey | CMAMHTPIXRUXNV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|