About 3-ethynyl-2,5-dimethylpyrazine
3-ethynyl-2,5-dimethylpyrazine (PubChem CID 13081757) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 3-ethynyl-2,5-dimethylpyrazine.
Molecular Properties
| Compound Name | 3-ethynyl-2,5-dimethylpyrazine |
| PubChem CID | 13081757 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 3-ethynyl-2,5-dimethylpyrazine |
| SMILES | C#Cc1nc(C)cnc1C |
| InChI | InChI=1S/C8H8N2/c1-4-8-7(3)9-5-6(2)10-8/h1,5H,2-3H3 |
| InChIKey | LTLWOMPANQWIQY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethynyl-2,5-dimethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethynyl-2,5-dimethylpyrazine?
The IUPAC name of 3-ethynyl-2,5-dimethylpyrazine (CID 13081757) is 3-ethynyl-2,5-dimethylpyrazine.
What is the SMILES notation for 3-ethynyl-2,5-dimethylpyrazine?
The canonical SMILES for 3-ethynyl-2,5-dimethylpyrazine is C#Cc1nc(C)cnc1C.
What is the InChIKey of 3-ethynyl-2,5-dimethylpyrazine?
The InChIKey is LTLWOMPANQWIQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c1-4-8-7(3)9-5-6(2)10-8/h1,5H,2-3H3.
What are the key properties of 3-ethynyl-2,5-dimethylpyrazine?
3-ethynyl-2,5-dimethylpyrazine has a molecular weight of 132.17 g/mol, XLogP of 1.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethynyl-2,5-dimethylpyrazine is sourced from PubChem (CID 13081757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).