About N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-N'-phenylmethanimidamide
N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-N'-phenylmethanimidamide (PubChem CID 13081759) has the molecular formula C13H15N5O2
and a molecular weight of 273.30 g/mol. Its IUPAC name is N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-N'-phenylmethanimidamide.
Molecular Properties
| Compound Name | N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-N'-phenylmethanimidamide |
| PubChem CID | 13081759 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-N'-phenylmethanimidamide |
| SMILES | Cn1c(NN/C=N/c2ccccc2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C13H15N5O2/c1-17-11(8-12(19)18(2)13(17)20)16-15-9-14-10-6-4-3-5-7-10/h3-9,16H,1-2H3,(H,14,15) |
| InChIKey | BYQNNLRTIMWFGZ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-N'-phenylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-N'-phenylmethanimidamide?
The IUPAC name of N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-N'-phenylmethanimidamide (CID 13081759) is N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-N'-phenylmethanimidamide.
What is the SMILES notation for N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-N'-phenylmethanimidamide?
The canonical SMILES for N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-N'-phenylmethanimidamide is Cn1c(NN/C=N/c2ccccc2)cc(=O)n(C)c1=O.
What is the InChIKey of N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-N'-phenylmethanimidamide?
The InChIKey is BYQNNLRTIMWFGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5O2/c1-17-11(8-12(19)18(2)13(17)20)16-15-9-14-10-6-4-3-5-7-10/h3-9,16H,1-2H3,(H,14,15).
What are the key properties of N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-N'-phenylmethanimidamide?
N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-N'-phenylmethanimidamide has a molecular weight of 273.30 g/mol, XLogP of 0.36, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)amino]-N'-phenylmethanimidamide is sourced from PubChem (CID 13081759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).