C14H25FN3P — CID 13081875
N,N,N',N'-Tetraethyl-N''-phenylphosphorodiamidimidic fluoride (PubChem CID 13081875) has the molecular formula C14H25FN3P and a molecular weight of 285.34 g/mol. Its IUPAC name is N-(diethylamino-fluoro-phenylimino-lambda5-phosphanyl)-N-ethylethanamine.
| Compound Name | N,N,N',N'-Tetraethyl-N''-phenylphosphorodiamidimidic fluoride |
|---|---|
| PubChem CID | 13081875 |
| Molecular Formula | C14H25FN3P |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | N-(diethylamino-fluoro-phenylimino-lambda5-phosphanyl)-N-ethylethanamine |
| SMILES | CCN(CC)P(=NC1=CC=CC=C1)(N(CC)CC)F |
| InChI | InChI=1S/C14H25FN3P/c1-5-17(6-2)19(15,18(7-3)8-4)16-14-12-10-9-11-13-14/h9-13H,5-8H2,1-4H3 |
| InChIKey | OABMXKSNGLWWPH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 18.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | 279 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|