C8H12ClNO2 — CID 130820188
2-chloro-N-[[(2R)-3,4-dihydro-2H-pyran-2-yl]methyl]acetamide (PubChem CID 130820188) has the molecular formula C8H12ClNO2 and a molecular weight of 189.64 g/mol. Its IUPAC name is 2-chloro-N-[[(2R)-3,4-dihydro-2H-pyran-2-yl]methyl]acetamide.
| Compound Name | 2-chloro-N-[[(2R)-3,4-dihydro-2H-pyran-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 130820188 |
| Molecular Formula | C8H12ClNO2 |
| Molecular Weight | 189.64 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2-chloro-N-[[(2R)-3,4-dihydro-2H-pyran-2-yl]methyl]acetamide |
| SMILES | O=C(CCl)NC[C@H]1CCC=CO1 |
| InChI | InChI=1S/C8H12ClNO2/c9-5-8(11)10-6-7-3-1-2-4-12-7/h2,4,7H,1,3,5-6H2,(H,10,11)/t7-/m1/s1 |
| InChIKey | ARZBKXSSLLGBSB-SSDOTTSWSA-N |
| XLogP | 1.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.64 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|