About (3R,4R)-4-bromo-1,1-dioxothiolane-3-thiol
(3R,4R)-4-bromo-1,1-dioxothiolane-3-thiol (PubChem CID 13082050) has the molecular formula C4H7BrO2S2
and a molecular weight of 231.14 g/mol. Its IUPAC name is (3R,4R)-4-bromo-1,1-dioxothiolane-3-thiol.
Molecular Properties
| Compound Name | (3R,4R)-4-bromo-1,1-dioxothiolane-3-thiol |
| PubChem CID | 13082050 |
| Molecular Formula | C4H7BrO2S2 |
| Molecular Weight | 231.14 g/mol |
| Exact Mass | 229.91 |
| IUPAC Name | (3R,4R)-4-bromo-1,1-dioxothiolane-3-thiol |
| SMILES | O=S1(=O)C[C@@H](S)[C@H](Br)C1 |
| InChI | InChI=1S/C4H7BrO2S2/c5-3-1-9(6,7)2-4(3)8/h3-4,8H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | XBCWDIOUPZFYNF-QWWZWVQMSA-N |
| XLogP | 0.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.14 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3R,4R)-4-bromo-1,1-dioxothiolane-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-4-bromo-1,1-dioxothiolane-3-thiol?
The IUPAC name of (3R,4R)-4-bromo-1,1-dioxothiolane-3-thiol (CID 13082050) is (3R,4R)-4-bromo-1,1-dioxothiolane-3-thiol.
What is the SMILES notation for (3R,4R)-4-bromo-1,1-dioxothiolane-3-thiol?
The canonical SMILES for (3R,4R)-4-bromo-1,1-dioxothiolane-3-thiol is O=S1(=O)C[C@@H](S)[C@H](Br)C1.
What is the InChIKey of (3R,4R)-4-bromo-1,1-dioxothiolane-3-thiol?
The InChIKey is XBCWDIOUPZFYNF-QWWZWVQMSA-N. The full InChI is InChI=1S/C4H7BrO2S2/c5-3-1-9(6,7)2-4(3)8/h3-4,8H,1-2H2/t3-,4-/m1/s1.
What are the key properties of (3R,4R)-4-bromo-1,1-dioxothiolane-3-thiol?
(3R,4R)-4-bromo-1,1-dioxothiolane-3-thiol has a molecular weight of 231.14 g/mol, XLogP of 0.48, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-4-bromo-1,1-dioxothiolane-3-thiol is sourced from PubChem (CID 13082050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).