About 1-[3-[(2-methyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]ethanone
1-[3-[(2-methyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]ethanone (PubChem CID 130825741) has the molecular formula C9H10N4O2
and a molecular weight of 206.21 g/mol. Its IUPAC name is 1-[3-[(2-methyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-[3-[(2-methyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]ethanone |
| PubChem CID | 130825741 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 1-[3-[(2-methyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]ethanone |
| SMILES | CC(=O)c1cnnn1Cc1coc(C)n1 |
| InChI | InChI=1S/C9H10N4O2/c1-6(14)9-3-10-12-13(9)4-8-5-15-7(2)11-8/h3,5H,4H2,1-2H3 |
| InChIKey | OAWGOWUNNYJHAI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[3-[(2-methyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(2-methyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]ethanone?
The IUPAC name of 1-[3-[(2-methyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]ethanone (CID 130825741) is 1-[3-[(2-methyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]ethanone.
What is the SMILES notation for 1-[3-[(2-methyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]ethanone?
The canonical SMILES for 1-[3-[(2-methyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]ethanone is CC(=O)c1cnnn1Cc1coc(C)n1.
What is the InChIKey of 1-[3-[(2-methyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]ethanone?
The InChIKey is OAWGOWUNNYJHAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c1-6(14)9-3-10-12-13(9)4-8-5-15-7(2)11-8/h3,5H,4H2,1-2H3.
What are the key properties of 1-[3-[(2-methyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]ethanone?
1-[3-[(2-methyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]ethanone has a molecular weight of 206.21 g/mol, XLogP of 0.83, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(2-methyl-1,3-oxazol-4-yl)methyl]triazol-4-yl]ethanone is sourced from PubChem (CID 130825741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).