About (3-methyloxan-4-yl)-(1,2-thiazol-5-yl)methanamine
(3-methyloxan-4-yl)-(1,2-thiazol-5-yl)methanamine (PubChem CID 130826279) has the molecular formula C10H16N2OS
and a molecular weight of 212.32 g/mol. Its IUPAC name is (3-methyloxan-4-yl)-(1,2-thiazol-5-yl)methanamine.
Molecular Properties
| Compound Name | (3-methyloxan-4-yl)-(1,2-thiazol-5-yl)methanamine |
| PubChem CID | 130826279 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (3-methyloxan-4-yl)-(1,2-thiazol-5-yl)methanamine |
| SMILES | CC1COCCC1C(N)c1ccns1 |
| InChI | InChI=1S/C10H16N2OS/c1-7-6-13-5-3-8(7)10(11)9-2-4-12-14-9/h2,4,7-8,10H,3,5-6,11H2,1H3 |
| InChIKey | LCMVNGCAMRMQIW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-methyloxan-4-yl)-(1,2-thiazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyloxan-4-yl)-(1,2-thiazol-5-yl)methanamine?
The IUPAC name of (3-methyloxan-4-yl)-(1,2-thiazol-5-yl)methanamine (CID 130826279) is (3-methyloxan-4-yl)-(1,2-thiazol-5-yl)methanamine.
What is the SMILES notation for (3-methyloxan-4-yl)-(1,2-thiazol-5-yl)methanamine?
The canonical SMILES for (3-methyloxan-4-yl)-(1,2-thiazol-5-yl)methanamine is CC1COCCC1C(N)c1ccns1.
What is the InChIKey of (3-methyloxan-4-yl)-(1,2-thiazol-5-yl)methanamine?
The InChIKey is LCMVNGCAMRMQIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2OS/c1-7-6-13-5-3-8(7)10(11)9-2-4-12-14-9/h2,4,7-8,10H,3,5-6,11H2,1H3.
What are the key properties of (3-methyloxan-4-yl)-(1,2-thiazol-5-yl)methanamine?
(3-methyloxan-4-yl)-(1,2-thiazol-5-yl)methanamine has a molecular weight of 212.32 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyloxan-4-yl)-(1,2-thiazol-5-yl)methanamine is sourced from PubChem (CID 130826279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).