About 1-[(2R,3S,8S)-8-(hydroxymethyl)-2-methyl-3-bicyclo[4.2.0]oct-1(6)-enyl]ethanol
1-[(2R,3S,8S)-8-(hydroxymethyl)-2-methyl-3-bicyclo[4.2.0]oct-1(6)-enyl]ethanol (PubChem CID 130831182) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-[(2R,3S,8S)-8-(hydroxymethyl)-2-methyl-3-bicyclo[4.2.0]oct-1(6)-enyl]ethanol.
Molecular Properties
| Compound Name | 1-[(2R,3S,8S)-8-(hydroxymethyl)-2-methyl-3-bicyclo[4.2.0]oct-1(6)-enyl]ethanol |
| PubChem CID | 130831182 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 1-[(2R,3S,8S)-8-(hydroxymethyl)-2-methyl-3-bicyclo[4.2.0]oct-1(6)-enyl]ethanol |
| SMILES | CC(O)[C@H]1CCC2=C([C@@H](CO)C2)[C@@H]1C |
| InChI | InChI=1S/C12H20O2/c1-7-11(8(2)14)4-3-9-5-10(6-13)12(7)9/h7-8,10-11,13-14H,3-6H2,1-2H3/t7-,8?,10-,11+/m1/s1 |
| InChIKey | AAXQVMVKJHFILD-IKBIKEAHSA-N |
| XLogP | 1.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2R,3S,8S)-8-(hydroxymethyl)-2-methyl-3-bicyclo[4.2.0]oct-1(6)-enyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R,3S,8S)-8-(hydroxymethyl)-2-methyl-3-bicyclo[4.2.0]oct-1(6)-enyl]ethanol?
The IUPAC name of 1-[(2R,3S,8S)-8-(hydroxymethyl)-2-methyl-3-bicyclo[4.2.0]oct-1(6)-enyl]ethanol (CID 130831182) is 1-[(2R,3S,8S)-8-(hydroxymethyl)-2-methyl-3-bicyclo[4.2.0]oct-1(6)-enyl]ethanol.
What is the SMILES notation for 1-[(2R,3S,8S)-8-(hydroxymethyl)-2-methyl-3-bicyclo[4.2.0]oct-1(6)-enyl]ethanol?
The canonical SMILES for 1-[(2R,3S,8S)-8-(hydroxymethyl)-2-methyl-3-bicyclo[4.2.0]oct-1(6)-enyl]ethanol is CC(O)[C@H]1CCC2=C([C@@H](CO)C2)[C@@H]1C.
What is the InChIKey of 1-[(2R,3S,8S)-8-(hydroxymethyl)-2-methyl-3-bicyclo[4.2.0]oct-1(6)-enyl]ethanol?
The InChIKey is AAXQVMVKJHFILD-IKBIKEAHSA-N. The full InChI is InChI=1S/C12H20O2/c1-7-11(8(2)14)4-3-9-5-10(6-13)12(7)9/h7-8,10-11,13-14H,3-6H2,1-2H3/t7-,8?,10-,11+/m1/s1.
What are the key properties of 1-[(2R,3S,8S)-8-(hydroxymethyl)-2-methyl-3-bicyclo[4.2.0]oct-1(6)-enyl]ethanol?
1-[(2R,3S,8S)-8-(hydroxymethyl)-2-methyl-3-bicyclo[4.2.0]oct-1(6)-enyl]ethanol has a molecular weight of 196.29 g/mol, XLogP of 1.72, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R,3S,8S)-8-(hydroxymethyl)-2-methyl-3-bicyclo[4.2.0]oct-1(6)-enyl]ethanol is sourced from PubChem (CID 130831182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).