C6H7ClO3 — CID 130831296
(1R,2R,3S,6S)-4-chloro-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol (PubChem CID 130831296) has the molecular formula C6H7ClO3 and a molecular weight of 162.57 g/mol. Its IUPAC name is (1R,2R,3S,6S)-4-chloro-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol.
| Compound Name | (1R,2R,3S,6S)-4-chloro-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol |
|---|---|
| PubChem CID | 130831296 |
| Molecular Formula | C6H7ClO3 |
| Molecular Weight | 162.57 g/mol |
| Exact Mass | 162.01 |
| IUPAC Name | (1R,2R,3S,6S)-4-chloro-7-oxabicyclo[4.1.0]hept-4-ene-2,3-diol |
| SMILES | O[C@H]1[C@H]2O[C@H]2C=C(Cl)[C@H]1O |
| InChI | InChI=1S/C6H7ClO3/c7-2-1-3-6(10-3)5(9)4(2)8/h1,3-6,8-9H/t3-,4+,5+,6-/m0/s1 |
| InChIKey | YFPWCHUEERBYRC-KCDKBNATSA-N |
| XLogP | -0.39 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.57 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|