C6H6Cl2F3NO — CID 130831642
N-[(2,2-dichlorocyclopropyl)methyl]-2,2,2-trifluoroacetamide (PubChem CID 130831642) has the molecular formula C6H6Cl2F3NO and a molecular weight of 236.02 g/mol. Its IUPAC name is N-[(2,2-dichlorocyclopropyl)methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2,2-dichlorocyclopropyl)methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 130831642 |
| Molecular Formula | C6H6Cl2F3NO |
| Molecular Weight | 236.02 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | N-[(2,2-dichlorocyclopropyl)methyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCC1CC1(Cl)Cl)C(F)(F)F |
| InChI | InChI=1S/C6H6Cl2F3NO/c7-5(8)1-3(5)2-12-4(13)6(9,10)11/h3H,1-2H2,(H,12,13) |
| InChIKey | AUIVKVUVBJFGFW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.02 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|