About 1-cyclohexyl-1-[1-(3,4-dichlorophenyl)cyclobutyl]-N-methylmethanamine;hydrochloride
1-cyclohexyl-1-[1-(3,4-dichlorophenyl)cyclobutyl]-N-methylmethanamine;hydrochloride (PubChem CID 13083211) has the molecular formula C18H26Cl3N
and a molecular weight of 362.77 g/mol. Its IUPAC name is 1-cyclohexyl-1-[1-(3,4-dichlorophenyl)cyclobutyl]-N-methylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-cyclohexyl-1-[1-(3,4-dichlorophenyl)cyclobutyl]-N-methylmethanamine;hydrochloride |
| PubChem CID | 13083211 |
| Molecular Formula | C18H26Cl3N |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 1-cyclohexyl-1-[1-(3,4-dichlorophenyl)cyclobutyl]-N-methylmethanamine;hydrochloride |
| SMILES | CNC(C1CCCCC1)C1(c2ccc(Cl)c(Cl)c2)CCC1.Cl |
| InChI | InChI=1S/C18H25Cl2N.ClH/c1-21-17(13-6-3-2-4-7-13)18(10-5-11-18)14-8-9-15(19)16(20)12-14;/h8-9,12-13,17,21H,2-7,10-11H2,1H3;1H |
| InChIKey | SNHPLEVRQJFDDJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexyl-1-[1-(3,4-dichlorophenyl)cyclobutyl]-N-methylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-1-[1-(3,4-dichlorophenyl)cyclobutyl]-N-methylmethanamine;hydrochloride?
The IUPAC name of 1-cyclohexyl-1-[1-(3,4-dichlorophenyl)cyclobutyl]-N-methylmethanamine;hydrochloride (CID 13083211) is 1-cyclohexyl-1-[1-(3,4-dichlorophenyl)cyclobutyl]-N-methylmethanamine;hydrochloride.
What is the SMILES notation for 1-cyclohexyl-1-[1-(3,4-dichlorophenyl)cyclobutyl]-N-methylmethanamine;hydrochloride?
The canonical SMILES for 1-cyclohexyl-1-[1-(3,4-dichlorophenyl)cyclobutyl]-N-methylmethanamine;hydrochloride is CNC(C1CCCCC1)C1(c2ccc(Cl)c(Cl)c2)CCC1.Cl.
What is the InChIKey of 1-cyclohexyl-1-[1-(3,4-dichlorophenyl)cyclobutyl]-N-methylmethanamine;hydrochloride?
The InChIKey is SNHPLEVRQJFDDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25Cl2N.ClH/c1-21-17(13-6-3-2-4-7-13)18(10-5-11-18)14-8-9-15(19)16(20)12-14;/h8-9,12-13,17,21H,2-7,10-11H2,1H3;1H.
What are the key properties of 1-cyclohexyl-1-[1-(3,4-dichlorophenyl)cyclobutyl]-N-methylmethanamine;hydrochloride?
1-cyclohexyl-1-[1-(3,4-dichlorophenyl)cyclobutyl]-N-methylmethanamine;hydrochloride has a molecular weight of 362.77 g/mol, XLogP of 6.01, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-1-[1-(3,4-dichlorophenyl)cyclobutyl]-N-methylmethanamine;hydrochloride is sourced from PubChem (CID 13083211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).