C9H18O2 — CID 130832826
2-[(3S,5S)-4,4,5-trimethyloxolan-3-yl]ethanol (PubChem CID 130832826) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is 2-[(3S,5S)-4,4,5-trimethyloxolan-3-yl]ethanol.
| Compound Name | 2-[(3S,5S)-4,4,5-trimethyloxolan-3-yl]ethanol |
|---|---|
| PubChem CID | 130832826 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 2-[(3S,5S)-4,4,5-trimethyloxolan-3-yl]ethanol |
| SMILES | C[C@@H]1OC[C@@H](CCO)C1(C)C |
| InChI | InChI=1S/C9H18O2/c1-7-9(2,3)8(4-5-10)6-11-7/h7-8,10H,4-6H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | SZXTVYTZHHOWFT-JGVFFNPUSA-N |
| XLogP | 1.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |