C14H17ClO2 — CID 13083372
2-[1-(4-chlorophenyl)cyclobutyl]-2-methylpropanoic acid (PubChem CID 13083372) has the molecular formula C14H17ClO2 and a molecular weight of 252.74 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)cyclobutyl]-2-methylpropanoic acid.
| Compound Name | 2-[1-(4-chlorophenyl)cyclobutyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 13083372 |
| Molecular Formula | C14H17ClO2 |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-[1-(4-chlorophenyl)cyclobutyl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)C1(c2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C14H17ClO2/c1-13(2,12(16)17)14(8-3-9-14)10-4-6-11(15)7-5-10/h4-7H,3,8-9H2,1-2H3,(H,16,17) |
| InChIKey | SASLBNHFUJFSGK-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |