C7H8O3 — CID 130834340
(4R,5R)-4,5-dihydroxycyclohepta-2,6-dien-1-one (PubChem CID 130834340) has the molecular formula C7H8O3 and a molecular weight of 140.14 g/mol. Its IUPAC name is (4R,5R)-4,5-dihydroxycyclohepta-2,6-dien-1-one.
| Compound Name | (4R,5R)-4,5-dihydroxycyclohepta-2,6-dien-1-one |
|---|---|
| PubChem CID | 130834340 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | (4R,5R)-4,5-dihydroxycyclohepta-2,6-dien-1-one |
| SMILES | O=C1C=C[C@@H](O)[C@H](O)C=C1 |
| InChI | InChI=1S/C7H8O3/c8-5-1-3-6(9)7(10)4-2-5/h1-4,6-7,9-10H/t6-,7-/m1/s1 |
| InChIKey | YDODNRFIMPTXRA-RNFRBKRXSA-N |
| XLogP | -0.60 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |